ChemNet > CAS > 1878-85-9 2-Methoxyphenoxyacetic acid
1878-85-9 2-Methoxyphenoxyacetic acid
| اسم المنتج |
2-Methoxyphenoxyacetic acid |
| الاسم بالانجليزية |
2-Methoxyphenoxyacetic acid;Guaiacoxyacetic acid; (2-Methoxyphenoxy)acetic acid; (o-Methoxyphenoxy)acetic acid; 3-06-00-04234 (Beilstein Handbook Reference); AI3-10575; Acide o-methoxyphenoxyacetique; Acide o-methoxyphenoxyacetique [French]; BRN 1874501; NSC 5165; Acetic acid, (2-methoxyphenoxy)-; Acetic acid, (o-methoxyphenoxy)-; (2-methoxyphenoxy)acetate |
| الصيغة الجزيئية |
C9H9O4 |
| الوزن الجزيئي الغرامي |
181.1659 |
| InChI |
InChI=1/C9H10O4/c1-12-7-4-2-3-5-8(7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| إستراتيجية المساعدة القطرية |
1878-85-9 |
| المفوضية الأوروبية رقم |
217-526-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
120-122℃ |
| نقطة الغليان |
303°C at 760 mmHg |
| نقطة الوميض |
120.9°C |
| ضغط البخار |
0.000423mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
