ChemNet > CAS > 18856-63-8 4-Ethylphenyl isothiocyanate
18856-63-8 4-Ethylphenyl isothiocyanate
| اسم المنتج |
4-Ethylphenyl isothiocyanate |
| الاسم بالانجليزية |
4-Ethylphenyl isothiocyanate; 4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| الصيغة الجزيئية |
C9H9NS |
| الوزن الجزيئي الغرامي |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| إستراتيجية المساعدة القطرية |
18856-63-8 |
| بنية جزيئية |
|
| كثافة |
1.01g/cm3 |
| نقطة الغليان |
257.8°C at 760 mmHg |
| معامل الإنكسار |
1.553 |
| نقطة الوميض |
110.2°C |
| ضغط البخار |
0.0229mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
