ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
| اسم المنتج |
4-Bromo-3-methoxyaniline |
| الاسم بالانجليزية |
4-Bromo-3-methoxyaniline; 4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine; 5-Amino-2-bromoanisole |
| الصيغة الجزيئية |
C13H10N2O4 |
| الوزن الجزيئي الغرامي |
258.2295 |
| InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
| إستراتيجية المساعدة القطرية |
19056-40-7 |
| بنية جزيئية |
|
| كثافة |
1.381g/cm3 |
| نقطة الغليان |
467°C at 760 mmHg |
| معامل الإنكسار |
1.655 |
| نقطة الوميض |
236.2°C |
| ضغط البخار |
6.74E-09mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
