ChemNet > CAS > 20261-31-8 4-Hydroxy-3-nitrocoumarin
20261-31-8 4-Hydroxy-3-nitrocoumarin
اسم المنتج |
4-Hydroxy-3-nitrocoumarin |
الاسم بالانجليزية |
4-Hydroxy-3-nitrocoumarin; 3-NITRO-4-HYDROXYCOUMARIN; 2-hydroxy-3-nitro-4H-chromen-4-one; 4-hydroxy-3-nitro-2H-chromen-2-one |
الصيغة الجزيئية |
C9H5NO5 |
الوزن الجزيئي الغرامي |
207.1397 |
InChI |
InChI=1/C9H5NO5/c11-8-5-3-1-2-4-6(5)15-9(12)7(8)10(13)14/h1-4,11H |
إستراتيجية المساعدة القطرية |
20261-31-8 |
بنية جزيئية |
|
كثافة |
1.638g/cm3 |
درجة الإنصهار |
171-173℃ |
نقطة الغليان |
364.492°C at 760 mmHg |
معامل الإنكسار |
1.674 |
نقطة الوميض |
174.239°C |
ضغط البخار |
0mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|