ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
اسم المنتج |
diethyl glutaconate, mixture of cis and tra |
الاسم بالانجليزية |
diethyl glutaconate, mixture of cis and tra; Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
الصيغة الجزيئية |
C9H14O4 |
الوزن الجزيئي الغرامي |
186.2051 |
InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
إستراتيجية المساعدة القطرية |
2049-67-4 |
المفوضية الأوروبية رقم |
218-069-2 |
بنية جزيئية |
|
كثافة |
1.048g/cm3 |
نقطة الغليان |
237°C at 760 mmHg |
معامل الإنكسار |
1.445 |
نقطة الوميض |
106.7°C |
ضغط البخار |
0.0459mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|