ChemNet > CAS > 20514-41-4 2,5-Dimethyl-2,4-hexadienedioic Acid
20514-41-4 2,5-Dimethyl-2,4-hexadienedioic Acid
| اسم المنتج |
2,5-Dimethyl-2,4-hexadienedioic Acid |
| الاسم بالانجليزية |
2,5-Dimethyl-2,4-hexadienedioic Acid; a,a-Dimethylmuconic acid; 2,5-dimethylhexa-2,4-dienedioic acid; (2E,4E)-2,5-dimethylhexa-2,4-dienedioic acid |
| الصيغة الجزيئية |
C8H10O4 |
| الوزن الجزيئي الغرامي |
170.1626 |
| InChI |
InChI=1/C8H10O4/c1-5(7(9)10)3-4-6(2)8(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/b5-3+,6-4+ |
| إستراتيجية المساعدة القطرية |
20514-41-4 |
| بنية جزيئية |
|
| كثافة |
1.245g/cm3 |
| نقطة الغليان |
351°C at 760 mmHg |
| معامل الإنكسار |
1.527 |
| نقطة الوميض |
180.3°C |
| ضغط البخار |
7.25E-06mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
