ChemNet > CAS > 207981-50-8 2,6-difluoromandelic acid
207981-50-8 2,6-difluoromandelic acid
اسم المنتج |
2,6-difluoromandelic acid |
الاسم بالانجليزية |
2,6-difluoromandelic acid; alpha-Hydroxy-2,6-difluorophenylacetic acid; (2,6-difluorophenyl)(hydroxy)acetic acid |
الصيغة الجزيئية |
C8H6F2O3 |
الوزن الجزيئي الغرامي |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
إستراتيجية المساعدة القطرية |
207981-50-8 |
بنية جزيئية |
|
كثافة |
1.522g/cm3 |
نقطة الغليان |
299.3°C at 760 mmHg |
معامل الإنكسار |
1.542 |
نقطة الوميض |
134.8°C |
ضغط البخار |
0.000539mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|