ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
اسم المنتج |
2,3,6-trifluoroacetophenone |
الاسم بالانجليزية |
2,3,6-trifluoroacetophenone; 2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
الصيغة الجزيئية |
C8H5F3O |
الوزن الجزيئي الغرامي |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
إستراتيجية المساعدة القطرية |
208173-22-2 |
بنية جزيئية |
|
كثافة |
1.303g/cm3 |
نقطة الغليان |
187.2°C at 760 mmHg |
معامل الإنكسار |
1.455 |
نقطة الوميض |
65°C |
ضغط البخار |
0.637mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|