ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
اسم المنتج |
(4-Methoxy-2-methylphenyl)boronic acid |
الاسم بالانجليزية |
(4-Methoxy-2-methylphenyl)boronic acid; 4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
الصيغة الجزيئية |
C8H11BO3 |
الوزن الجزيئي الغرامي |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
إستراتيجية المساعدة القطرية |
208399-66-0 |
بنية جزيئية |
|
كثافة |
1.14g/cm3 |
نقطة الغليان |
327.1°C at 760 mmHg |
معامل الإنكسار |
1.52 |
نقطة الوميض |
151.6°C |
ضغط البخار |
8.4E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|