ChemNet > CAS > 2210-28-8 n-Propyl methacrylate
2210-28-8 n-Propyl methacrylate
| اسم المنتج |
n-Propyl methacrylate |
| الاسم بالانجليزية |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
| الصيغة الجزيئية |
C7H12O2 |
| الوزن الجزيئي الغرامي |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
| إستراتيجية المساعدة القطرية |
2210-28-8 |
| المفوضية الأوروبية رقم |
218-639-0 |
| بنية جزيئية |
|
| كثافة |
0.899g/cm3 |
| نقطة الغليان |
141°C at 760 mmHg |
| معامل الإنكسار |
1.416 |
| نقطة الوميض |
34.7°C |
| ضغط البخار |
5.98mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
