ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
اسم المنتج |
5-Bromo-2-methyl-2-pentene |
الاسم بالانجليزية |
5-Bromo-2-methyl-2-pentene; 5-bromo-2-methylpent-2-ene |
الصيغة الجزيئية |
C6H11Br |
الوزن الجزيئي الغرامي |
163.0555 |
InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
إستراتيجية المساعدة القطرية |
2270-59-9 |
بنية جزيئية |
|
كثافة |
1.215g/cm3 |
نقطة الغليان |
152.6°C at 760 mmHg |
معامل الإنكسار |
1.47 |
نقطة الوميض |
22.8°C |
ضغط البخار |
4.44mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|