ChemNet > CAS > 2351-37-3 Biphenyldicarbonylchloride
2351-37-3 Biphenyldicarbonylchloride
| اسم المنتج |
Biphenyldicarbonylchloride |
| الاسم بالانجليزية |
Biphenyldicarbonylchloride; 4,4-Biphenyldicarbonyl chloride; 4,4'-Biphenyldicarbonyl Chloride |
| الصيغة الجزيئية |
C14H8Cl2O2 |
| الوزن الجزيئي الغرامي |
279.1181 |
| InChI |
InChI=1/C14H8Cl2O2/c15-13(17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(16)18/h1-8H |
| إستراتيجية المساعدة القطرية |
2351-37-3 |
| المفوضية الأوروبية رقم |
219-085-2 |
| بنية جزيئية |
|
| كثافة |
1.344g/cm3 |
| درجة الإنصهار |
184℃ |
| نقطة الغليان |
407.8°C at 760 mmHg |
| معامل الإنكسار |
1.603 |
| نقطة الوميض |
224.1°C |
| ضغط البخار |
7.35E-07mmHg at 25°C |
| علامات على البضائع الخطرة |
 C:Corrosive;
|
| خطر المصطلحات |
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
