2401-24-3 6-Chloro-m-anisidine
اسم المنتج |
6-Chloro-m-anisidine |
الاسم بالانجليزية |
6-Chloro-m-anisidine; 2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
الصيغة الجزيئية |
C7H9Cl2NO |
الوزن الجزيئي الغرامي |
194.0585 |
InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
إستراتيجية المساعدة القطرية |
2401-24-3 |
المفوضية الأوروبية رقم |
219-277-6 |
بنية جزيئية |
|
درجة الإنصهار |
207℃ |
نقطة الغليان |
255°C at 760 mmHg |
نقطة الوميض |
108°C |
ضغط البخار |
0.0168mmHg at 25°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|