ChemNet > CAS > 2426-07-5 1,2,7,8-Diepoxyoctane
2426-07-5 1,2,7,8-Diepoxyoctane
| اسم المنتج |
1,2,7,8-Diepoxyoctane |
| الاسم بالانجليزية |
1,2,7,8-Diepoxyoctane; Octadienediepoxide; 1,7-Octadiene diepoxide; 1,2,7,8-Dipoxyoctane, >97%; 2,2'-butane-1,4-diyldioxirane; (2R,2'S)-2,2'-butane-1,4-diyldioxirane; (2S,2'S)-2,2'-butane-1,4-diyldioxirane |
| الصيغة الجزيئية |
C8H14O2 |
| الوزن الجزيئي الغرامي |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2/t7-,8-/m0/s1 |
| إستراتيجية المساعدة القطرية |
2426-07-5 |
| المفوضية الأوروبية رقم |
219-375-9 |
| بنية جزيئية |
|
| كثافة |
1.051g/cm3 |
| نقطة الغليان |
240°C at 760 mmHg |
| معامل الإنكسار |
1.477 |
| نقطة الوميض |
97.8°C |
| ضغط البخار |
0.0602mmHg at 25°C |
| علامات على البضائع الخطرة |
 T:Toxic;
|
| خطر المصطلحات |
R22:Harmful if swallowed.;
R24:Toxic in contact with skin.;
R40:Possible risks of irreversible effects.;
|
| شروط الأمن |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
