ChemNet > CAS > 247940-06-3 2-(Dicyclohexylphosphino)biphenyl
247940-06-3 2-(Dicyclohexylphosphino)biphenyl
اسم المنتج |
2-(Dicyclohexylphosphino)biphenyl |
الاسم بالانجليزية |
2-(Dicyclohexylphosphino)biphenyl; (2-Biphenylyl)dicyclohexylphosphine; biphenyl-2-yl(dicyclohexyl)phosphane; CyJohnPhos |
الصيغة الجزيئية |
C24H31P |
الوزن الجزيئي الغرامي |
350.4767 |
InChI |
InChI=1/C24H31P/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)25(21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1,4-5,10-13,18-19,21-22H,2-3,6-9,14-17H2 |
إستراتيجية المساعدة القطرية |
247940-06-3 |
بنية جزيئية |
|
درجة الإنصهار |
103℃ |
نقطة الغليان |
499.5°C at 760 mmHg |
نقطة الوميض |
271.7°C |
ضغط البخار |
1.27E-09mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|