ChemNet > CAS > 2693-46-1 3-Aminofluoranthene
2693-46-1 3-Aminofluoranthene
| اسم المنتج |
3-Aminofluoranthene |
| الاسم بالانجليزية |
3-Aminofluoranthene; 3-Fluoranthenamine; fluoranthen-3-ylamine; fluoranthen-3-amine |
| الصيغة الجزيئية |
C16H11N |
| الوزن الجزيئي الغرامي |
217.2652 |
| InChI |
InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
| إستراتيجية المساعدة القطرية |
2693-46-1 |
| المفوضية الأوروبية رقم |
220-263-7 |
| بنية جزيئية |
|
| كثافة |
1.322g/cm3 |
| درجة الإنصهار |
115-117℃ |
| نقطة الغليان |
440.8°C at 760 mmHg |
| معامل الإنكسار |
1.904 |
| نقطة الوميض |
246.2°C |
| ضغط البخار |
5.71E-08mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
