286-99-7 Cyclododecane epoxide
اسم المنتج |
Cyclododecane epoxide |
الاسم بالانجليزية |
Cyclododecane epoxide; Cyclododecane epoxide, mixture of cis andtrans isomers; Cyclododecene oxide (cis+trans); Cyclododecane oxide; Epoxy N-Dodecane; 13-oxabicyclo[10.1.0]tridecane; (1R,12R)-13-oxabicyclo[10.1.0]tridecane; (1R,12S)-13-oxabicyclo[10.1.0]tridecane; (1S,12S)-13-oxabicyclo[10.1.0]tridecane |
الصيغة الجزيئية |
C12H22O |
الوزن الجزيئي الغرامي |
182.3025 |
InChI |
InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
إستراتيجية المساعدة القطرية |
286-99-7 |
المفوضية الأوروبية رقم |
206-012-4 |
بنية جزيئية |
|
كثافة |
0.899g/cm3 |
درجة الإنصهار |
-7℃ |
نقطة الغليان |
237.4°C at 760 mmHg |
معامل الإنكسار |
1.455 |
نقطة الوميض |
82.2°C |
ضغط البخار |
0.0691mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R38:;
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|