2873-74-7 Glutaryl dichloride
اسم المنتج |
Glutaryl dichloride |
الاسم بالانجليزية |
Glutaryl dichloride; Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
الصيغة الجزيئية |
C5H6Cl2O2 |
الوزن الجزيئي الغرامي |
169.0059 |
InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
إستراتيجية المساعدة القطرية |
2873-74-7 |
المفوضية الأوروبية رقم |
220-711-1 |
بنية جزيئية |
|
كثافة |
1.319g/cm3 |
نقطة الغليان |
217.8°C at 760 mmHg |
معامل الإنكسار |
1.458 |
نقطة الوميض |
106.7°C |
ضغط البخار |
0.13mmHg at 25°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|