ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
اسم المنتج |
Dimethyl phenylphosphonite |
الاسم بالانجليزية |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
الصيغة الجزيئية |
C8H11O2P |
الوزن الجزيئي الغرامي |
170.1455 |
InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
إستراتيجية المساعدة القطرية |
2946-61-4 |
المفوضية الأوروبية رقم |
220-960-6 |
بنية جزيئية |
|
نقطة الغليان |
194.1°C at 760 mmHg |
نقطة الوميض |
81°C |
ضغط البخار |
0.628mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|