ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
اسم المنتج |
5-methyl-2-nitrobenzoic acid |
الاسم بالانجليزية |
5-methyl-2-nitrobenzoic acid; 6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
الصيغة الجزيئية |
C8H7NO4 |
الوزن الجزيئي الغرامي |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
إستراتيجية المساعدة القطرية |
3113-72-2 |
المفوضية الأوروبية رقم |
221-481-5 |
بنية جزيئية |
|
كثافة |
1.392g/cm3 |
درجة الإنصهار |
134-136℃ |
نقطة الغليان |
367.6°C at 760 mmHg |
معامل الإنكسار |
1.6 |
نقطة الوميض |
166.8°C |
ضغط البخار |
4.72E-06mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|