ChemNet > CAS > 3125-64-2 3-Methoxyphenyl isothiocyanate
3125-64-2 3-Methoxyphenyl isothiocyanate
| اسم المنتج |
3-Methoxyphenyl isothiocyanate |
| الاسم بالانجليزية |
3-Methoxyphenyl isothiocyanate; m-Anisyl isothiocyanate; 3-(Isothiocyanato)-anisole |
| الصيغة الجزيئية |
C8H7NOS |
| الوزن الجزيئي الغرامي |
165.20 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| إستراتيجية المساعدة القطرية |
3125-64-2 |
| بنية جزيئية |
|
| كثافة |
1.179 |
| نقطة الغليان |
133℃(10 torr) |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
