ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
| اسم المنتج |
Methyl 2,4,6-trihydroxybenzoate |
| الاسم بالانجليزية |
Methyl 2,4,6-trihydroxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
| الصيغة الجزيئية |
C8H8O5 |
| الوزن الجزيئي الغرامي |
184.1461 |
| InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
| إستراتيجية المساعدة القطرية |
3147-39-5 |
| المفوضية الأوروبية رقم |
221-566-7 |
| بنية جزيئية |
|
| كثافة |
1.501g/cm3 |
| درجة الإنصهار |
174-176℃ |
| نقطة الغليان |
359.5°C at 760 mmHg |
| معامل الإنكسار |
1.63 |
| نقطة الوميض |
150.3°C |
| ضغط البخار |
1.14E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
