ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
اسم المنتج |
2-Chloro-6-fluoro-3-methylbenzoic acid |
الاسم بالانجليزية |
2-Chloro-6-fluoro-3-methylbenzoic acid; 2-Chloro-6-fluoro-m-toluic acid |
الصيغة الجزيئية |
C8H6ClFO2 |
الوزن الجزيئي الغرامي |
188.5834 |
InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
إستراتيجية المساعدة القطرية |
32890-89-4 |
بنية جزيئية |
|
كثافة |
1.403g/cm3 |
نقطة الغليان |
278.1°C at 760 mmHg |
معامل الإنكسار |
1.551 |
نقطة الوميض |
122°C |
ضغط البخار |
0.00209mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|