ChemNet > CAS > 3327-22-8 (3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.
3327-22-8 (3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.
| اسم المنتج |
(3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S. |
| الاسم بالانجليزية |
(3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.; (3-Chloro-2-hydroxypropyl)trimethylammonium chloride; 3-chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride; 3-chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium; 1-amino-3-chloropropan-2-ol hydrochloride (1:1); 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride |
| الصيغة الجزيئية |
C3H9Cl2NO |
| الوزن الجزيئي الغرامي |
146.0157 |
| InChI |
InChI=1/C3H8ClNO.ClH/c4-1-3(6)2-5;/h3,6H,1-2,5H2;1H |
| إستراتيجية المساعدة القطرية |
3327-22-8 |
| المفوضية الأوروبية رقم |
222-048-3 |
| بنية جزيئية |
|
| درجة الإنصهار |
191-193℃ |
| نقطة الغليان |
240.2°C at 760 mmHg |
| نقطة الوميض |
99.1°C |
| ضغط البخار |
0.0067mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
