ChemNet > CAS > 3365-85-3 4,4''-Diamino-p-terphenyl
3365-85-3 4,4''-Diamino-p-terphenyl
| اسم المنتج |
4,4''-Diamino-p-terphenyl |
| الاسم بالانجليزية |
4,4''-Diamino-p-terphenyl; 4,4''-Diaminoterphenyl; CCRIS 4965; (1,1':4',1''-Terphenyl)-4,4''-diamine; p,p'-Diaminoterphenyl |
| الصيغة الجزيئية |
C18H16N2 |
| الوزن الجزيئي الغرامي |
260.333 |
| InChI |
InChI=1/C18H16N2/c19-17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(20)12-8-16/h1-12H,19-20H2 |
| إستراتيجية المساعدة القطرية |
3365-85-3 |
| بنية جزيئية |
|
| كثافة |
1.159g/cm3 |
| نقطة الغليان |
484.2°C at 760 mmHg |
| معامل الإنكسار |
1.67 |
| نقطة الوميض |
296.3°C |
| ضغط البخار |
1.57E-09mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| شروط الأمن |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
