ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
| اسم المنتج |
3-Bromothioanisole |
| الاسم بالانجليزية |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| الصيغة الجزيئية |
C7H7BrOS |
| الوزن الجزيئي الغرامي |
219.0989 |
| InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| إستراتيجية المساعدة القطرية |
33733-73-2 |
| بنية جزيئية |
|
| كثافة |
1.567g/cm3 |
| نقطة الغليان |
278.106°C at 760 mmHg |
| معامل الإنكسار |
1.616 |
| نقطة الوميض |
121.995°C |
| ضغط البخار |
0.007mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
| شروط الأمن |
S23:;
S24/25:;
|
|
