ChemNet > CAS > 33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
| اسم المنتج |
3,4-Dimethoxyphenyl isothiocyanate |
| الاسم بالانجليزية |
3,4-Dimethoxyphenyl isothiocyanate; 3,4-Dimethoxyisothiocyanatobenzene; 4-isothiocyanato-1,2-dimethoxybenzene |
| الصيغة الجزيئية |
C9H9NO2S |
| الوزن الجزيئي الغرامي |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
| إستراتيجية المساعدة القطرية |
33904-04-0 |
| بنية جزيئية |
|
| كثافة |
1.12g/cm3 |
| درجة الإنصهار |
47-172℃ |
| نقطة الغليان |
311°C at 760 mmHg |
| معامل الإنكسار |
1.537 |
| نقطة الوميض |
141.9°C |
| ضغط البخار |
0.00106mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
