ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
اسم المنتج |
2-Phenylethyl-1-boronic acid |
الاسم بالانجليزية |
2-Phenylethyl-1-boronic acid; Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
الصيغة الجزيئية |
C8H9BO2 |
الوزن الجزيئي الغرامي |
147.9669 |
InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
إستراتيجية المساعدة القطرية |
34420-17-2 |
بنية جزيئية |
|
كثافة |
1.13g/cm3 |
نقطة الغليان |
315.9°C at 760 mmHg |
معامل الإنكسار |
1.587 |
نقطة الوميض |
144.9°C |
ضغط البخار |
0.000179mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|