ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
اسم المنتج |
dipropylene glycol monomethyl ether, mixture of isomers |
الاسم بالانجليزية |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
الصيغة الجزيئية |
C7H16O3 |
الوزن الجزيئي الغرامي |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
إستراتيجية المساعدة القطرية |
34590-94-8 |
المفوضية الأوروبية رقم |
252-104-2 |
بنية جزيئية |
|
كثافة |
0.958g/cm3 |
نقطة الغليان |
155.6°C at 760 mmHg |
معامل الإنكسار |
1.423 |
نقطة الوميض |
47.9°C |
ضغط البخار |
1.09mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S23:;
S24/25:;
|
|