3468-53-9 Phenyl nicotinate
اسم المنتج |
Phenyl nicotinate |
الاسم بالانجليزية |
Phenyl nicotinate; Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
الصيغة الجزيئية |
C12H9NO2 |
الوزن الجزيئي الغرامي |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
إستراتيجية المساعدة القطرية |
3468-53-9 |
المفوضية الأوروبية رقم |
222-428-9 |
بنية جزيئية |
|
كثافة |
1.199g/cm3 |
درجة الإنصهار |
70-72℃ |
نقطة الغليان |
338.9°C at 760 mmHg |
معامل الإنكسار |
1.589 |
نقطة الوميض |
158.8°C |
ضغط البخار |
9.51E-05mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
شروط الأمن |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|