ChemNet > CAS > 3512-18-3 2,3,6-Trifluoropyridine
3512-18-3 2,3,6-Trifluoropyridine
| اسم المنتج |
2,3,6-Trifluoropyridine |
| الاسم بالانجليزية |
2,3,6-Trifluoropyridine; |
| الصيغة الجزيئية |
C5H2F3N |
| الوزن الجزيئي الغرامي |
133.0713 |
| InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| إستراتيجية المساعدة القطرية |
3512-18-3 |
| بنية جزيئية |
|
| كثافة |
1.396g/cm3 |
| نقطة الغليان |
123.7°C at 760 mmHg |
| معامل الإنكسار |
1.424 |
| نقطة الوميض |
28.6°C |
| ضغط البخار |
15.9mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
