35354-37-1 1-Bromo-5-methylhexane
اسم المنتج |
1-Bromo-5-methylhexane |
الاسم بالانجليزية |
1-Bromo-5-methylhexane; |
الصيغة الجزيئية |
C7H15Br |
الوزن الجزيئي الغرامي |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
إستراتيجية المساعدة القطرية |
35354-37-1 |
بنية جزيئية |
|
كثافة |
1.136g/cm3 |
نقطة الغليان |
168°C at 760 mmHg |
معامل الإنكسار |
1.447 |
نقطة الوميض |
48.4°C |
ضغط البخار |
2.18mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|