ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
| اسم المنتج |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
| الاسم بالانجليزية |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile;1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
| الصيغة الجزيئية |
C14H17NO |
| الوزن الجزيئي الغرامي |
215.2909 |
| InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| إستراتيجية المساعدة القطرية |
36263-51-1 |
| المفوضية الأوروبية رقم |
252-938-7 |
| بنية جزيئية |
|
| كثافة |
1.06g/cm3 |
| درجة الإنصهار |
40-45℃ |
| نقطة الغليان |
362°C at 760 mmHg |
| معامل الإنكسار |
1.538 |
| نقطة الوميض |
152.6°C |
| ضغط البخار |
2E-05mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
