ChemNet > CAS > 36556-56-6 6-Chloro-2,4-difluoroaniline
36556-56-6 6-Chloro-2,4-difluoroaniline
| اسم المنتج |
6-Chloro-2,4-difluoroaniline |
| الاسم بالانجليزية |
6-Chloro-2,4-difluoroaniline; 2-chloro-4,6-difluoroaniline |
| الصيغة الجزيئية |
C6H4ClF2N |
| الوزن الجزيئي الغرامي |
163.5525 |
| InChI |
InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2 |
| إستراتيجية المساعدة القطرية |
36556-56-6 |
| بنية جزيئية |
|
| كثافة |
1.459g/cm3 |
| درجة الإنصهار |
28℃ |
| نقطة الغليان |
208.3°C at 760 mmHg |
| معامل الإنكسار |
1.543 |
| نقطة الوميض |
92.2°C |
| ضغط البخار |
0.215mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
