ChemNet > CAS > 3696-23-9 4-Chlorophenylthiourea
3696-23-9 4-Chlorophenylthiourea
| اسم المنتج |
4-Chlorophenylthiourea |
| الاسم بالانجليزية |
4-Chlorophenylthiourea;Thourea, (4-chlorophenyl)- (9CI); (4-Chlorophenyl)thiourea; 1-(p-Chlorophenyl)-2-thiourea; 1-(p-Chlorophenyl)thiourea; 4-12-00-01206 (Beilstein Handbook Reference); 4-Chlorophenyl thiourea; BRN 0973258; N-(4-Chlorophenyl)thiourea; N-(p-Chlorophenyl)thiourea; NSC 72217; 4-Chlorophenyl-2-thiourea; Thiourea, (4-chlorophenyl)- (9CI); Urea, 1-(p-chlorophenyl)-2-thio-; 1-(4-chlorophenyl)thiourea |
| الصيغة الجزيئية |
C7H7ClN2S |
| الوزن الجزيئي الغرامي |
186.6619 |
| InChI |
InChI=1/C7H7ClN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| إستراتيجية المساعدة القطرية |
3696-23-9 |
| المفوضية الأوروبية رقم |
223-022-4 |
| بنية جزيئية |
|
| كثافة |
1.441g/cm3 |
| نقطة الغليان |
298.7°C at 760 mmHg |
| معامل الإنكسار |
1.727 |
| نقطة الوميض |
134.5°C |
| ضغط البخار |
0.00125mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R28:Very toxic if swallowed.;
|
| شروط الأمن |
S22:Do not inhale dust.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
