ChemNet > CAS > 3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
3715-29-5 3-Methyl-2-oxobutanoic acid, sodium salt
اسم المنتج |
3-Methyl-2-oxobutanoic acid, sodium salt |
الاسم بالانجليزية |
3-Methyl-2-oxobutanoic acid, sodium salt; 3-methyl-2-oxobutyric acid sodium salt; A-ketoisovaleric acid sodium; sodium 3-methyl-2-oxobutanoate; Sodium 3-methyl-2-oxobutyrate; 3-Methyl-2-oxobutanoic acid sodium salt; 3-methyl-2-oxobutanoic acid; 3-methyl-2-oxobutanoate |
الصيغة الجزيئية |
C5H7O3 |
الوزن الجزيئي الغرامي |
115.1078 |
InChI |
InChI=1/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8)/p-1 |
إستراتيجية المساعدة القطرية |
3715-29-5 |
المفوضية الأوروبية رقم |
223-062-2 |
بنية جزيئية |
|
درجة الإنصهار |
227-230℃ (dec.) |
نقطة الغليان |
170.2°C at 760 mmHg |
نقطة الوميض |
71°C |
ضغط البخار |
0.732mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|