ChemNet > CAS > 3759-28-2 alpha-Cyano-o-tolunitrile
3759-28-2 alpha-Cyano-o-tolunitrile
| اسم المنتج |
alpha-Cyano-o-tolunitrile |
| الاسم بالانجليزية |
alpha-Cyano-o-tolunitrile; a-Cyano-o-tolunitrile; alpha-cyano-ortho-tolunitrile; alpha,o-toluenedicarbonitrile; 2-Cyanophenylacetonitrile; 2-(cyanomethyl)benzonitrile; 2-Cyanobenzyl cyanide |
| الصيغة الجزيئية |
C9H6N2 |
| الوزن الجزيئي الغرامي |
142.1573 |
| InChI |
InChI=1/C9H6N2/c10-6-5-8-3-1-2-4-9(8)7-11/h1-4H,5H2 |
| إستراتيجية المساعدة القطرية |
3759-28-2 |
| المفوضية الأوروبية رقم |
223-167-3 |
| بنية جزيئية |
|
| كثافة |
1.12g/cm3 |
| درجة الإنصهار |
76℃ |
| نقطة الغليان |
293.8°C at 760 mmHg |
| معامل الإنكسار |
1.553 |
| نقطة الوميض |
140.7°C |
| ضغط البخار |
0.00169mmHg at 25°C |
| علامات على البضائع الخطرة |
 T:Toxic;
|
| خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
