ChemNet > CAS > 3773-14-6 2,4,5-Trichlorothiophenol
3773-14-6 2,4,5-Trichlorothiophenol
| اسم المنتج |
2,4,5-Trichlorothiophenol |
| الاسم بالانجليزية |
2,4,5-Trichlorothiophenol; 2,4,5-Trichlorobenzenethiol; Trichlorothiophenol; 2,4,5-trichlorobenzenethiolate |
| الصيغة الجزيئية |
C6H2Cl3S |
| الوزن الجزيئي الغرامي |
212.5046 |
| InChI |
InChI=1/C6H3Cl3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/p-1 |
| إستراتيجية المساعدة القطرية |
3773-14-6 |
| المفوضية الأوروبية رقم |
223-223-7 |
| بنية جزيئية |
|
| درجة الإنصهار |
117-118℃ |
| نقطة الغليان |
283.2°C at 760 mmHg |
| نقطة الوميض |
114.6°C |
| ضغط البخار |
0.0055mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
