اسم المنتج |
cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid |
الاسم بالانجليزية |
cis,cis,cis,cis-1,2,3,4-Cyclopentanetetracarboxylic acid; r-1,c-2,c-3,c-4-Cyclopentanetetracarboxylic acid; AI3-50868; 1,2,3,4-Cyclopentanetetracarboxylic acid, (1alpha,2alpha,3alpha,4alpha)-; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylic acid; (1R,2R,3R,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4S)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3R,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (1R,2R,3S,4R)-cyclopentane-1,2,3,4-tetracarboxylate; (2R,3S,4R,5S)-tetrahydrofuran-2,3,4,5-tetracarboxylate (non-preferred name) |
الصيغة الجزيئية |
C8H4O9 |
الوزن الجزيئي الغرامي |
244.1142 |
InChI |
InChI=1/C8H8O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/p-4/t1-,2+,3+,4- |
إستراتيجية المساعدة القطرية |
3786-91-2 |
المفوضية الأوروبية رقم |
223-256-7 |
بنية جزيئية |
|
درجة الإنصهار |
192-195℃ |
نقطة الغليان |
597.011°C at 760 mmHg |
نقطة الوميض |
243.903°C |
ضغط البخار |
0mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|