39593-08-3 Methylphenylpiperazine
اسم المنتج |
Methylphenylpiperazine |
الاسم بالانجليزية |
Methylphenylpiperazine; 1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
الصيغة الجزيئية |
C11H16N2 |
الوزن الجزيئي الغرامي |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
إستراتيجية المساعدة القطرية |
39593-08-3 |
المفوضية الأوروبية رقم |
254-534-6 |
بنية جزيئية |
|
كثافة |
1.012g/cm3 |
نقطة الغليان |
321.2°C at 760 mmHg |
معامل الإنكسار |
1.54 |
نقطة الوميض |
153.8°C |
ضغط البخار |
0.000303mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|