ChemNet > CAS > 39635-11-5 3,4-Dihydroxybenzhydrazide
39635-11-5 3,4-Dihydroxybenzhydrazide
اسم المنتج |
3,4-Dihydroxybenzhydrazide |
الاسم بالانجليزية |
3,4-Dihydroxybenzhydrazide; 3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide |
الصيغة الجزيئية |
C7H8N2O3 |
الوزن الجزيئي الغرامي |
168.15 |
InChI |
InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12) |
إستراتيجية المساعدة القطرية |
39635-11-5 |
المفوضية الأوروبية رقم |
254-550-3 |
بنية جزيئية |
|
كثافة |
1.477g/cm3 |
معامل الإنكسار |
1.67 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|