39959-59-6 4-Iodobenzylamine
اسم المنتج |
4-Iodobenzylamine |
الاسم بالانجليزية |
4-Iodobenzylamine; 4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
الصيغة الجزيئية |
C7H8IN |
الوزن الجزيئي الغرامي |
233.0496 |
InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
إستراتيجية المساعدة القطرية |
39959-59-6 |
بنية جزيئية |
|
كثافة |
1.772g/cm3 |
نقطة الغليان |
250.4°C at 760 mmHg |
معامل الإنكسار |
1.644 |
نقطة الوميض |
105.2°C |
ضغط البخار |
0.0217mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|