ChemNet > CAS > 40357-96-8 2-Nitrothiophene-4-carboxylic acid
40357-96-8 2-Nitrothiophene-4-carboxylic acid
اسم المنتج |
2-Nitrothiophene-4-carboxylic acid |
الاسم بالانجليزية |
2-Nitrothiophene-4-carboxylic acid; 5-Nitrothiophene-3-carboxylic acid; 5-nitrothiophene-3-carboxylate |
الصيغة الجزيئية |
C5H2NO4S |
الوزن الجزيئي الغرامي |
172.1392 |
InChI |
InChI=1/C5H3NO4S/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)/p-1 |
إستراتيجية المساعدة القطرية |
40357-96-8 |
بنية جزيئية |
|
درجة الإنصهار |
145-146℃ |
نقطة الغليان |
367.2°C at 760 mmHg |
نقطة الوميض |
175.9°C |
ضغط البخار |
4.88E-06mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|