ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
اسم المنتج |
4,4'-Biphenyldiboronic acid |
الاسم بالانجليزية |
4,4'-Biphenyldiboronic acid;biphenyl-4,4'-diyldiboronic acid |
الصيغة الجزيئية |
C12H12B2O4 |
الوزن الجزيئي الغرامي |
241.8433 |
InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
إستراتيجية المساعدة القطرية |
4151-80-8 |
بنية جزيئية |
|
كثافة |
1.31g/cm3 |
درجة الإنصهار |
300℃ (dec.) |
نقطة الغليان |
505.9°C at 760 mmHg |
معامل الإنكسار |
1.62 |
نقطة الوميض |
259.7°C |
ضغط البخار |
4.69E-11mmHg at 25°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|