4160-51-4 4'-methoxybutyrophenone
اسم المنتج |
4'-methoxybutyrophenone |
الاسم بالانجليزية |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
الصيغة الجزيئية |
C11H14O2 |
الوزن الجزيئي الغرامي |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
إستراتيجية المساعدة القطرية |
4160-51-4 |
المفوضية الأوروبية رقم |
223-995-5 |
بنية جزيئية |
|
كثافة |
1.001g/cm3 |
نقطة الغليان |
288.3°C at 760 mmHg |
معامل الإنكسار |
1.498 |
نقطة الوميض |
124.3°C |
ضغط البخار |
0.00236mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|