ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| اسم المنتج |
2-Bromo-4,6-dimethylaniline |
| الاسم بالانجليزية |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| الصيغة الجزيئية |
C8H10BrN |
| الوزن الجزيئي الغرامي |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
41825-73-4 |
| المفوضية الأوروبية رقم |
246-337-9 |
| بنية جزيئية |
|
| كثافة |
1.424g/cm3 |
| درجة الإنصهار |
49-79℃ |
| نقطة الغليان |
260.9°C at 760 mmHg |
| معامل الإنكسار |
1.596 |
| نقطة الوميض |
111.6°C |
| ضغط البخار |
0.0119mmHg at 25°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
