ChemNet > CAS > 42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
| اسم المنتج |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| الاسم بالانجليزية |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile; (6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| الصيغة الجزيئية |
C10H12N2S |
| الوزن الجزيئي الغرامي |
192.2807 |
| InChI |
InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
| إستراتيجية المساعدة القطرية |
42225-04-7 |
| بنية جزيئية |
|
| كثافة |
1.22g/cm3 |
| درجة الإنصهار |
147℃ |
| نقطة الغليان |
392.8°C at 760 mmHg |
| معامل الإنكسار |
1.607 |
| نقطة الوميض |
191.4°C |
| ضغط البخار |
2.23E-06mmHg at 25°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|
