433-53-4 methyl difluoroacetate
اسم المنتج |
methyl difluoroacetate |
الاسم بالانجليزية |
methyl difluoroacetate; Difluoroacetic acid methyl ester; 1,1,2,3,3-pentafluoroprop-1-ene; Methyl 2,2-difluoroacetate |
الصيغة الجزيئية |
C3HF5 |
الوزن الجزيئي الغرامي |
132.0321 |
InChI |
InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
إستراتيجية المساعدة القطرية |
433-53-4 |
المفوضية الأوروبية رقم |
207-089-7 |
بنية جزيئية |
|
كثافة |
1.335g/cm3 |
معامل الإنكسار |
1.264 |
ضغط البخار |
2220mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R11:Highly flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|