ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
اسم المنتج |
2-aminothiophene-3-carbonitrile |
الاسم بالانجليزية |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
الصيغة الجزيئية |
C5H4N2S |
الوزن الجزيئي الغرامي |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
إستراتيجية المساعدة القطرية |
4651-82-5 |
بنية جزيئية |
|
كثافة |
1.33g/cm3 |
درجة الإنصهار |
104℃ |
نقطة الغليان |
317.5°C at 760 mmHg |
معامل الإنكسار |
1.627 |
نقطة الوميض |
145.8°C |
ضغط البخار |
0.000384mmHg at 25°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|