ChemNet > CAS > 4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
اسم المنتج |
2,4-Dihydroxy-3,6-dimethylbenzoic acid |
الاسم بالانجليزية |
2,4-Dihydroxy-3,6-dimethylbenzoic acid; 3,6-Dimethyl-2,4-dihydroxybenzoic acid |
الصيغة الجزيئية |
C9H10O4 |
الوزن الجزيئي الغرامي |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
إستراتيجية المساعدة القطرية |
4707-46-4 |
بنية جزيئية |
|
كثافة |
1.386g/cm3 |
نقطة الغليان |
407.4°C at 760 mmHg |
معامل الإنكسار |
1.627 |
نقطة الوميض |
214.3°C |
ضغط البخار |
2.29E-07mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|